C25H34N2O4Si — CID 127034444
N-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-N-phenylmethoxybenzamide (PubChem CID 127034444) has the molecular formula C25H34N2O4Si and a molecular weight of 454.64 g/mol. Its IUPAC name is N-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-N-phenylmethoxybenzamide.
| Compound Name | N-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 127034444 |
| Molecular Formula | C25H34N2O4Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | N-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-N-phenylmethoxybenzamide |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1N(OCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O4Si/c1-18(31-32(5,6)25(2,3)4)21-22(26-23(21)28)27(24(29)20-15-11-8-12-16-20)30-17-19-13-9-7-10-14-19/h7-16,18,21-22H,17H2,1-6H3,(H,26,28)/t18-,21-,22-/m1/s1 |
| InChIKey | DKWRGFMPVDRQDF-STZQEDGTSA-N |
| XLogP | 4.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|