C19H32N2O3Si — CID 122221433
(3R,4R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-pyridin-4-ylpropoxy)azetidin-2-one (PubChem CID 122221433) has the molecular formula C19H32N2O3Si and a molecular weight of 364.56 g/mol. Its IUPAC name is (3R,4R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-pyridin-4-ylpropoxy)azetidin-2-one.
| Compound Name | (3R,4R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-pyridin-4-ylpropoxy)azetidin-2-one |
|---|---|
| PubChem CID | 122221433 |
| Molecular Formula | C19H32N2O3Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3R,4R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-pyridin-4-ylpropoxy)azetidin-2-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1OCCCc1ccncc1 |
| InChI | InChI=1S/C19H32N2O3Si/c1-14(24-25(5,6)19(2,3)4)16-17(22)21-18(16)23-13-7-8-15-9-11-20-12-10-15/h9-12,14,16,18H,7-8,13H2,1-6H3,(H,21,22)/t14-,16-,18+/m0/s1 |
| InChIKey | ALNGHTUVBFSGEQ-QILLFSRXSA-N |
| XLogP | 3.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|