C32H38NO5P — CID 87852710
tert-butyl N-[7-ethoxy-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)heptyl]carbamate (PubChem CID 87852710) has the molecular formula C32H38NO5P and a molecular weight of 547.63 g/mol. Its IUPAC name is tert-butyl N-[7-ethoxy-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)heptyl]carbamate.
| Compound Name | tert-butyl N-[7-ethoxy-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)heptyl]carbamate |
|---|---|
| PubChem CID | 87852710 |
| Molecular Formula | C32H38NO5P |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | tert-butyl N-[7-ethoxy-4,6-dioxo-5-(triphenyl-λ5-phosphanylidene)heptyl]carbamate |
| SMILES | CCOCC(=O)C(C(=O)CCCNC(=O)OC(C)(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38NO5P/c1-5-37-24-29(35)30(28(34)22-15-23-33-31(36)38-32(2,3)4)39(25-16-9-6-10-17-25,26-18-11-7-12-19-26)27-20-13-8-14-21-27/h6-14,16-21H,5,15,22-24H2,1-4H3,(H,33,36) |
| InChIKey | ZSVGCYANLHKIMZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|