C19H25N2O3P — CID 98469800
tert-butyl N-[2-(diphenylphosphorylamino)ethyl]carbamate (PubChem CID 98469800) has the molecular formula C19H25N2O3P and a molecular weight of 360.39 g/mol. Its IUPAC name is tert-butyl N-[2-(diphenylphosphorylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(diphenylphosphorylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 98469800 |
| Molecular Formula | C19H25N2O3P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl N-[2-(diphenylphosphorylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N2O3P/c1-19(2,3)24-18(22)20-14-15-21-25(23,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | BRVAAKUBSNUWOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|