C37H46NO7P — CID 10556183
ditert-butyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanedioate (PubChem CID 10556183) has the molecular formula C37H46NO7P and a molecular weight of 647.75 g/mol. Its IUPAC name is ditert-butyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanedioate.
| Compound Name | ditert-butyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanedioate |
|---|---|
| PubChem CID | 10556183 |
| Molecular Formula | C37H46NO7P |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | ditert-butyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)C(C(=O)OC(C)(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H46NO7P/c1-35(2,3)43-32(40)29(38-34(42)45-37(7,8)9)25-30(39)31(33(41)44-36(4,5)6)46(26-19-13-10-14-20-26,27-21-15-11-16-22-27)28-23-17-12-18-24-28/h10-24,29H,25H2,1-9H3,(H,38,42)/t29-/m0/s1 |
| InChIKey | AEAOTHIIOAZPIL-LJAQVGFWSA-N |
| XLogP | 5.69 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|