C36H35N2O5P — CID 54318947
benzyl 5-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 54318947) has the molecular formula C36H35N2O5P and a molecular weight of 606.66 g/mol. Its IUPAC name is benzyl 5-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate.
| Compound Name | benzyl 5-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 54318947 |
| Molecular Formula | C36H35N2O5P |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | benzyl 5-cyano-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H35N2O5P/c1-36(2,3)43-35(41)38-31(24-33(39)42-26-27-16-8-4-9-17-27)34(40)32(25-37)44(28-18-10-5-11-19-28,29-20-12-6-13-21-29)30-22-14-7-15-23-30/h4-23,31H,24,26H2,1-3H3,(H,38,41) |
| InChIKey | SQFUFEMSSUTVGN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|