C33H29N2O5P — CID 54286761
benzyl 5-cyano-3-(methoxycarbonylamino)-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 54286761) has the molecular formula C33H29N2O5P and a molecular weight of 564.58 g/mol. Its IUPAC name is benzyl 5-cyano-3-(methoxycarbonylamino)-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate.
| Compound Name | benzyl 5-cyano-3-(methoxycarbonylamino)-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 54286761 |
| Molecular Formula | C33H29N2O5P |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | benzyl 5-cyano-3-(methoxycarbonylamino)-4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | COC(=O)NC(CC(=O)OCc1ccccc1)C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H29N2O5P/c1-39-33(38)35-29(22-31(36)40-24-25-14-6-2-7-15-25)32(37)30(23-34)41(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21,29H,22,24H2,1H3,(H,35,38) |
| InChIKey | RUQPTKBVUXHMLD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|