C21H27NO5 — CID 134868456
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-phenylhex-5-ynoate (PubChem CID 134868456) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-phenylhex-5-ynoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-phenylhex-5-ynoate |
|---|---|
| PubChem CID | 134868456 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-phenylhex-5-ynoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)C#Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27NO5/c1-20(2,3)26-18(24)17(22-19(25)27-21(4,5)6)14-16(23)13-12-15-10-8-7-9-11-15/h7-11,17H,14H2,1-6H3,(H,22,25) |
| InChIKey | YTKNWZBSZINRQM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|