C25H29NO4S — CID 11626327
ethyl (2R)-3-(1,3-diphenylprop-2-ynylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 11626327) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is ethyl (2R)-3-(1,3-diphenylprop-2-ynylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2R)-3-(1,3-diphenylprop-2-ynylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 11626327 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | ethyl (2R)-3-(1,3-diphenylprop-2-ynylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)[C@H](CSC(C#Cc1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29NO4S/c1-5-29-23(27)21(26-24(28)30-25(2,3)4)18-31-22(20-14-10-7-11-15-20)17-16-19-12-8-6-9-13-19/h6-15,21-22H,5,18H2,1-4H3,(H,26,28)/t21-,22?/m0/s1 |
| InChIKey | VIIVXEGDCBWLPY-HMTLIYDFSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|