C21H32ClNO3S — CID 19817175
[5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;hydrochloride (PubChem CID 19817175) has the molecular formula C21H32ClNO3S and a molecular weight of 414.01 g/mol. Its IUPAC name is [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;hydrochloride.
| Compound Name | [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 19817175 |
| Molecular Formula | C21H32ClNO3S |
| Molecular Weight | 414.01 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [5-(diethylamino)-2-methylpent-3-yn-2-yl] 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;hydrochloride |
| SMILES | CCN(CC)CC#CC(C)(C)OC(=O)C(O)(c1cccs1)C1CCCC1.Cl |
| InChI | InChI=1S/C21H31NO3S.ClH/c1-5-22(6-2)15-10-14-20(3,4)25-19(23)21(24,17-11-7-8-12-17)18-13-9-16-26-18;/h9,13,16-17,24H,5-8,11-12,15H2,1-4H3;1H |
| InChIKey | LFOFHGRCMDCIQU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.01 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|