C18H21NOS — CID 7117868
(1S)-4-(diethylamino)-1-phenyl-1-thiophen-2-ylbut-2-yn-1-ol (PubChem CID 7117868) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is (1S)-4-(diethylamino)-1-phenyl-1-thiophen-2-ylbut-2-yn-1-ol.
| Compound Name | (1S)-4-(diethylamino)-1-phenyl-1-thiophen-2-ylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 7117868 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1S)-4-(diethylamino)-1-phenyl-1-thiophen-2-ylbut-2-yn-1-ol |
| SMILES | CCN(CC)CC#C[C@@](O)(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H21NOS/c1-3-19(4-2)14-9-13-18(20,17-12-8-15-21-17)16-10-6-5-7-11-16/h5-8,10-12,15,20H,3-4,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | SXVKTKWFUYPPRC-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|