C22H27NO — CID 2835423
4-(diethylamino)-4-methyl-1,1-diphenylpent-2-yn-1-ol (PubChem CID 2835423) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 4-(diethylamino)-4-methyl-1,1-diphenylpent-2-yn-1-ol.
| Compound Name | 4-(diethylamino)-4-methyl-1,1-diphenylpent-2-yn-1-ol |
|---|---|
| PubChem CID | 2835423 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 4-(diethylamino)-4-methyl-1,1-diphenylpent-2-yn-1-ol |
| SMILES | CCN(CC)C(C)(C)C#CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-5-23(6-2)21(3,4)17-18-22(24,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,24H,5-6H2,1-4H3 |
| InChIKey | JBTLYYUMVZGAEL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|