C22H22O3 — CID 54503444
1-(2,2,2-triphenylethoxy)ethane-1,1-diol (PubChem CID 54503444) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(2,2,2-triphenylethoxy)ethane-1,1-diol.
| Compound Name | 1-(2,2,2-triphenylethoxy)ethane-1,1-diol |
|---|---|
| PubChem CID | 54503444 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(2,2,2-triphenylethoxy)ethane-1,1-diol |
| SMILES | CC(O)(O)OCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O3/c1-21(23,24)25-17-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23-24H,17H2,1H3 |
| InChIKey | YEAYLSLSGLUNIY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|