C21H22OSi — CID 148920069
methyl(2,2,2-triphenylethoxy)silane (PubChem CID 148920069) has the molecular formula C21H22OSi and a molecular weight of 318.49 g/mol. Its IUPAC name is methyl(2,2,2-triphenylethoxy)silane.
| Compound Name | methyl(2,2,2-triphenylethoxy)silane |
|---|---|
| PubChem CID | 148920069 |
| Molecular Formula | C21H22OSi |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl(2,2,2-triphenylethoxy)silane |
| SMILES | C[SiH2]OCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22OSi/c1-23-22-17-21(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,17,23H2,1H3 |
| InChIKey | MRGQSWVKLLRBRJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|