C20H26O2 — CID 131848966
(1,4-dimethoxy-2,3-dimethyl-3-phenylbutan-2-yl)benzene (PubChem CID 131848966) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1,4-dimethoxy-2,3-dimethyl-3-phenylbutan-2-yl)benzene.
| Compound Name | (1,4-dimethoxy-2,3-dimethyl-3-phenylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 131848966 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1,4-dimethoxy-2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| SMILES | COCC(C)(c1ccccc1)C(C)(COC)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-19(15-21-3,17-11-7-5-8-12-17)20(2,16-22-4)18-13-9-6-10-14-18/h5-14H,15-16H2,1-4H3 |
| InChIKey | OWDBLBVSORQVJZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |