C21H28O — CID 170451960
(6-methoxy-2,3-dimethyl-2-phenylhexan-3-yl)benzene (PubChem CID 170451960) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is (6-methoxy-2,3-dimethyl-2-phenylhexan-3-yl)benzene.
| Compound Name | (6-methoxy-2,3-dimethyl-2-phenylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 170451960 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (6-methoxy-2,3-dimethyl-2-phenylhexan-3-yl)benzene |
| SMILES | COCCCC(C)(c1ccccc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28O/c1-20(2,18-12-7-5-8-13-18)21(3,16-11-17-22-4)19-14-9-6-10-15-19/h5-10,12-15H,11,16-17H2,1-4H3 |
| InChIKey | FVTQGRROTCOJOI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|