C22H30S — CID 170451967
(2,3-dimethyl-7-methylsulfanyl-2-phenylheptan-3-yl)benzene (PubChem CID 170451967) has the molecular formula C22H30S and a molecular weight of 326.55 g/mol. Its IUPAC name is (2,3-dimethyl-7-methylsulfanyl-2-phenylheptan-3-yl)benzene.
| Compound Name | (2,3-dimethyl-7-methylsulfanyl-2-phenylheptan-3-yl)benzene |
|---|---|
| PubChem CID | 170451967 |
| Molecular Formula | C22H30S |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (2,3-dimethyl-7-methylsulfanyl-2-phenylheptan-3-yl)benzene |
| SMILES | CSCCCCC(C)(c1ccccc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H30S/c1-21(2,19-13-7-5-8-14-19)22(3,17-11-12-18-23-4)20-15-9-6-10-16-20/h5-10,13-16H,11-12,17-18H2,1-4H3 |
| InChIKey | QNPHJTUEOJIXKX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|