C25H37N — CID 134331731
4-(3-ethyl-4-methyl-3-phenyldecan-4-yl)aniline (PubChem CID 134331731) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is 4-(3-ethyl-4-methyl-3-phenyldecan-4-yl)aniline.
| Compound Name | 4-(3-ethyl-4-methyl-3-phenyldecan-4-yl)aniline |
|---|---|
| PubChem CID | 134331731 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 4-(3-ethyl-4-methyl-3-phenyldecan-4-yl)aniline |
| SMILES | CCCCCCC(C)(c1ccc(N)cc1)C(CC)(CC)c1ccccc1 |
| InChI | InChI=1S/C25H37N/c1-5-8-9-13-20-24(4,21-16-18-23(26)19-17-21)25(6-2,7-3)22-14-11-10-12-15-22/h10-12,14-19H,5-9,13,20,26H2,1-4H3 |
| InChIKey | LLKOQMGPFZTFOU-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|