C16H26 — CID 158389582
[(3S)-2,2,3-trimethylheptan-3-yl]benzene (PubChem CID 158389582) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is [(3S)-2,2,3-trimethylheptan-3-yl]benzene.
| Compound Name | [(3S)-2,2,3-trimethylheptan-3-yl]benzene |
|---|---|
| PubChem CID | 158389582 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | [(3S)-2,2,3-trimethylheptan-3-yl]benzene |
| SMILES | CCCC[C@](C)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H26/c1-6-7-13-16(5,15(2,3)4)14-11-9-8-10-12-14/h8-12H,6-7,13H2,1-5H3/t16-/m1/s1 |
| InChIKey | DAVJEYHWKNIIHZ-MRXNPFEDSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |