C20H32O — CID 175329982
3-methyl-3-phenyl-2,2-dipropylheptanal (PubChem CID 175329982) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is 3-methyl-3-phenyl-2,2-dipropylheptanal.
| Compound Name | 3-methyl-3-phenyl-2,2-dipropylheptanal |
|---|---|
| PubChem CID | 175329982 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3-methyl-3-phenyl-2,2-dipropylheptanal |
| SMILES | CCCCC(C)(c1ccccc1)C(C=O)(CCC)CCC |
| InChI | InChI=1S/C20H32O/c1-5-8-16-19(4,18-12-10-9-11-13-18)20(17-21,14-6-2)15-7-3/h9-13,17H,5-8,14-16H2,1-4H3 |
| InChIKey | BCEWKUZATURJAP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|