C24H36 — CID 166095952
[(5R,6R,7E)-6-butyl-7-ethenyl-5,6-dimethyldeca-7,9-dien-5-yl]benzene (PubChem CID 166095952) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is [(5R,6R,7E)-6-butyl-7-ethenyl-5,6-dimethyldeca-7,9-dien-5-yl]benzene.
| Compound Name | [(5R,6R,7E)-6-butyl-7-ethenyl-5,6-dimethyldeca-7,9-dien-5-yl]benzene |
|---|---|
| PubChem CID | 166095952 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | [(5R,6R,7E)-6-butyl-7-ethenyl-5,6-dimethyldeca-7,9-dien-5-yl]benzene |
| SMILES | C=C/C=C(\C=C)[C@@](C)(CCCC)[C@](C)(CCCC)c1ccccc1 |
| InChI | InChI=1S/C24H36/c1-7-11-19-23(5,21(10-4)16-9-3)24(6,20-12-8-2)22-17-14-13-15-18-22/h9-10,13-18H,3-4,7-8,11-12,19-20H2,1-2,5-6H3/b21-16+/t23-,24-/m1/s1 |
| InChIKey | BHVRSVZVWJXOHE-YSXQIUAXSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|