C30H32IN — CID 170058694
N-[4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]-N-iodo-4-(2-phenylpropan-2-yl)aniline (PubChem CID 170058694) has the molecular formula C30H32IN and a molecular weight of 533.50 g/mol. Its IUPAC name is N-[4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]-N-iodo-4-(2-phenylpropan-2-yl)aniline.
| Compound Name | N-[4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]-N-iodo-4-(2-phenylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 170058694 |
| Molecular Formula | C30H32IN |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | N-[4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]-N-iodo-4-(2-phenylpropan-2-yl)aniline |
| SMILES | C=C/C=C(\C=C)C(C)(C)c1ccc(N(I)c2ccc(C(C)(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H32IN/c1-7-12-23(8-2)29(3,4)25-15-19-27(20-16-25)32(31)28-21-17-26(18-22-28)30(5,6)24-13-10-9-11-14-24/h7-22H,1-2H2,3-6H3/b23-12+ |
| InChIKey | YFYXFLGDMSRLEP-FSJBWODESA-N |
| XLogP | 9.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|