C53H62O6P2 — CID 142136555
3,9-bis[2-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 142136555) has the molecular formula C53H62O6P2 and a molecular weight of 857.02 g/mol. Its IUPAC name is 3,9-bis[2-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[2-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 142136555 |
| Molecular Formula | C53H62O6P2 |
| Molecular Weight | 857.02 g/mol |
| Exact Mass | 856.40 |
| IUPAC Name | 3,9-bis[2-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | C=C/C=C(\C=C)C(C)(C)c1cc(C(C)(C)c2ccccc2)ccc1OP1OCC2(CO1)COP(Oc1ccc(C(C)(C)c3ccccc3)cc1C(C)(C)/C(C=C)=C/C=C)OC2 |
| InChI | InChI=1S/C53H62O6P2/c1-13-23-39(15-3)51(9,10)45-33-43(49(5,6)41-25-19-17-20-26-41)29-31-47(45)58-60-54-35-53(36-55-60)37-56-61(57-38-53)59-48-32-30-44(50(7,8)42-27-21-18-22-28-42)34-46(48)52(11,12)40(16-4)24-14-2/h13-34H,1-4,35-38H2,5-12H3/b39-23+,40-24+ |
| InChIKey | CRQOXJNIOLZODX-DBMXBCQFSA-N |
| XLogP | 14.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.02 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|