C17H21NO — CID 144957240
O-[2-ethenyl-4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]hydroxylamine (PubChem CID 144957240) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is O-[2-ethenyl-4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]hydroxylamine.
| Compound Name | O-[2-ethenyl-4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 144957240 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | O-[2-ethenyl-4-[(3E)-3-ethenyl-2-methylhexa-3,5-dien-2-yl]phenyl]hydroxylamine |
| SMILES | C=C/C=C(\C=C)C(C)(C)c1ccc(ON)c(C=C)c1 |
| InChI | InChI=1S/C17H21NO/c1-6-9-14(8-3)17(4,5)15-10-11-16(19-18)13(7-2)12-15/h6-12H,1-3,18H2,4-5H3/b14-9+ |
| InChIKey | BKXBPXGYWCQUIO-NTEUORMPSA-N |
| XLogP | 4.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|