C27H27NO — CID 126487276
1-amino-1-[4-[2-[4-[(4E)-4-ethenyl-3,3-dimethylhepta-4,6-dien-1-ynyl]phenyl]ethynyl]phenyl]ethanol (PubChem CID 126487276) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-amino-1-[4-[2-[4-[(4E)-4-ethenyl-3,3-dimethylhepta-4,6-dien-1-ynyl]phenyl]ethynyl]phenyl]ethanol.
| Compound Name | 1-amino-1-[4-[2-[4-[(4E)-4-ethenyl-3,3-dimethylhepta-4,6-dien-1-ynyl]phenyl]ethynyl]phenyl]ethanol |
|---|---|
| PubChem CID | 126487276 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-amino-1-[4-[2-[4-[(4E)-4-ethenyl-3,3-dimethylhepta-4,6-dien-1-ynyl]phenyl]ethynyl]phenyl]ethanol |
| SMILES | C=C/C=C(\C=C)C(C)(C)C#Cc1ccc(C#Cc2ccc(C(C)(N)O)cc2)cc1 |
| InChI | InChI=1S/C27H27NO/c1-6-8-24(7-2)26(3,4)20-19-23-13-11-21(12-14-23)9-10-22-15-17-25(18-16-22)27(5,28)29/h6-8,11-18,29H,1-2,28H2,3-5H3/b24-8+ |
| InChIKey | ZNUWIYXGCRPSRT-KTZMUZOWSA-N |
| XLogP | 4.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|