C24H40O2 — CID 143292323
ethane;2-[(3E,5Z)-3-ethenyl-2,7-dimethylocta-3,5-dien-2-yl]-1,4-dimethoxybenzene (PubChem CID 143292323) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-3-ethenyl-2,7-dimethylocta-3,5-dien-2-yl]-1,4-dimethoxybenzene.
| Compound Name | ethane;2-[(3E,5Z)-3-ethenyl-2,7-dimethylocta-3,5-dien-2-yl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 143292323 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | ethane;2-[(3E,5Z)-3-ethenyl-2,7-dimethylocta-3,5-dien-2-yl]-1,4-dimethoxybenzene |
| SMILES | C=C/C(=C\C=C/C(C)C)C(C)(C)c1cc(OC)ccc1OC.CC.CC |
| InChI | InChI=1S/C20H28O2.2C2H6/c1-8-16(11-9-10-15(2)3)20(4,5)18-14-17(21-6)12-13-19(18)22-7;2*1-2/h8-15H,1H2,2-7H3;2*1-2H3/b10-9-,16-11+;; |
| InChIKey | BUMGMPHAXFWODK-IMIQFAJWSA-N |
| XLogP | 7.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|