C12H17F2NO2 — CID 116839369
1-(2,5-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-amine (PubChem CID 116839369) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-amine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 116839369 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-amine |
| SMILES | COc1ccc(OC)c(C(F)(F)C(C)(C)N)c1 |
| InChI | InChI=1S/C12H17F2NO2/c1-11(2,15)12(13,14)9-7-8(16-3)5-6-10(9)17-4/h5-7H,15H2,1-4H3 |
| InChIKey | JKXUQCUOLRSBCN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |