C16H18ClNO2 — CID 62801327
1-(3-chlorophenyl)-1-(2,5-dimethoxyphenyl)ethanamine (PubChem CID 62801327) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-(2,5-dimethoxyphenyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-1-(2,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 62801327 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(3-chlorophenyl)-1-(2,5-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(OC)c(C(C)(N)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C16H18ClNO2/c1-16(18,11-5-4-6-12(17)9-11)14-10-13(19-2)7-8-15(14)20-3/h4-10H,18H2,1-3H3 |
| InChIKey | VIOAROOODCYJGW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |