C14H12ClF2N — CID 62789192
1-(3-chlorophenyl)-1-(3,5-difluorophenyl)ethanamine (PubChem CID 62789192) has the molecular formula C14H12ClF2N and a molecular weight of 267.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-(3,5-difluorophenyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-1-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 62789192 |
| Molecular Formula | C14H12ClF2N |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(3-chlorophenyl)-1-(3,5-difluorophenyl)ethanamine |
| SMILES | CC(N)(c1cc(F)cc(F)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12ClF2N/c1-14(18,9-3-2-4-11(15)5-9)10-6-12(16)8-13(17)7-10/h2-8H,18H2,1H3 |
| InChIKey | QMTAKISRERWEOE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |