C12H16F3NO3 — CID 63083616
3-amino-2-(2,5-dimethoxyphenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 63083616) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-amino-2-(2,5-dimethoxyphenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 3-amino-2-(2,5-dimethoxyphenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 63083616 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-amino-2-(2,5-dimethoxyphenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | COc1ccc(OC)c(C(O)(C(C)N)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO3/c1-7(16)11(17,12(13,14)15)9-6-8(18-2)4-5-10(9)19-3/h4-7,17H,16H2,1-3H3 |
| InChIKey | ZJXSUAXSUUEXAA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |