C13H18F3NO3 — CID 63082925
3-amino-2-(2,4-dimethoxyphenyl)-1,1,1-trifluoropentan-2-ol (PubChem CID 63082925) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-amino-2-(2,4-dimethoxyphenyl)-1,1,1-trifluoropentan-2-ol.
| Compound Name | 3-amino-2-(2,4-dimethoxyphenyl)-1,1,1-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 63082925 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-amino-2-(2,4-dimethoxyphenyl)-1,1,1-trifluoropentan-2-ol |
| SMILES | CCC(N)C(O)(c1ccc(OC)cc1OC)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO3/c1-4-11(17)12(18,13(14,15)16)9-6-5-8(19-2)7-10(9)20-3/h5-7,11,18H,4,17H2,1-3H3 |
| InChIKey | AUCGZBZJNAZZQR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |