C11H12F3NO4 — CID 162538995
2-(2,4-dimethoxyphenyl)-1,1,1-trifluoro-3-hydroxyiminopropan-2-ol (PubChem CID 162538995) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1,1,1-trifluoro-3-hydroxyiminopropan-2-ol.
| Compound Name | 2-(2,4-dimethoxyphenyl)-1,1,1-trifluoro-3-hydroxyiminopropan-2-ol |
|---|---|
| PubChem CID | 162538995 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1,1,1-trifluoro-3-hydroxyiminopropan-2-ol |
| SMILES | COc1ccc(C(O)(C=NO)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C11H12F3NO4/c1-18-7-3-4-8(9(5-7)19-2)10(16,6-15-17)11(12,13)14/h3-6,16-17H,1-2H3 |
| InChIKey | MXKJFXKXEGECSU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|