C17H28N2O2 — CID 43830156
3-(2,5-dimethoxyphenyl)-2-N,2-N,5-trimethylhex-5-ene-2,3-diamine (PubChem CID 43830156) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-N,2-N,5-trimethylhex-5-ene-2,3-diamine.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-N,2-N,5-trimethylhex-5-ene-2,3-diamine |
|---|---|
| PubChem CID | 43830156 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-N,2-N,5-trimethylhex-5-ene-2,3-diamine |
| SMILES | C=C(C)CC(N)(c1cc(OC)ccc1OC)C(C)N(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-12(2)11-17(18,13(3)19(4)5)15-10-14(20-6)8-9-16(15)21-7/h8-10,13H,1,11,18H2,2-7H3 |
| InChIKey | FVHKPQNSJVBXBJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|