C53H62N4O2P2 — CID 141356478
3,9-bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraza-3,9-diphosphaspiro[5.5]undecane (PubChem CID 141356478) has the molecular formula C53H62N4O2P2 and a molecular weight of 849.05 g/mol. Its IUPAC name is 3,9-bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraza-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraza-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 141356478 |
| Molecular Formula | C53H62N4O2P2 |
| Molecular Weight | 849.05 g/mol |
| Exact Mass | 848.43 |
| IUPAC Name | 3,9-bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraza-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(c1ccccc1)c1ccc(OP2NCC3(CN2)CNP(Oc2ccc(C(C)(C)c4ccccc4)cc2C(C)(C)c2ccccc2)NC3)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C53H62N4O2P2/c1-49(2,39-21-13-9-14-22-39)43-29-31-47(45(33-43)51(5,6)41-25-17-11-18-26-41)58-60-54-35-53(36-55-60)37-56-61(57-38-53)59-48-32-30-44(50(3,4)40-23-15-10-16-24-40)34-46(48)52(7,8)42-27-19-12-20-28-42/h9-34,54-57H,35-38H2,1-8H3 |
| InChIKey | UCICYKMOCLUDJC-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.05 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|