C54H62O6P2 — CID 160523829
3-[2,4-bis(2-phenylpropan-2-yl)phenoxy]-9-[2-(2-phenylpropan-2-yl)-4-propan-2-ylphenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;toluene (PubChem CID 160523829) has the molecular formula C54H62O6P2 and a molecular weight of 869.03 g/mol. Its IUPAC name is 3-[2,4-bis(2-phenylpropan-2-yl)phenoxy]-9-[2-(2-phenylpropan-2-yl)-4-propan-2-ylphenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;toluene.
| Compound Name | 3-[2,4-bis(2-phenylpropan-2-yl)phenoxy]-9-[2-(2-phenylpropan-2-yl)-4-propan-2-ylphenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;toluene |
|---|---|
| PubChem CID | 160523829 |
| Molecular Formula | C54H62O6P2 |
| Molecular Weight | 869.03 g/mol |
| Exact Mass | 868.40 |
| IUPAC Name | 3-[2,4-bis(2-phenylpropan-2-yl)phenoxy]-9-[2-(2-phenylpropan-2-yl)-4-propan-2-ylphenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;toluene |
| SMILES | CC(C)c1ccc(OP2OCC3(CO2)COP(Oc2ccc(C(C)(C)c4ccccc4)cc2C(C)(C)c2ccccc2)OC3)c(C(C)(C)c2ccccc2)c1.Cc1ccccc1 |
| InChI | InChI=1S/C47H54O6P2.C7H8/c1-34(2)35-24-26-42(40(28-35)45(5,6)37-20-14-10-15-21-37)52-54-48-30-47(31-49-54)32-50-55(51-33-47)53-43-27-25-39(44(3,4)36-18-12-9-13-19-36)29-41(43)46(7,8)38-22-16-11-17-23-38;1-7-5-3-2-4-6-7/h9-29,34H,30-33H2,1-8H3;2-6H,1H3 |
| InChIKey | QUQCZIMRNHIUDA-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.03 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|