C52H59O2P — CID 162462392
bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-tert-butylphosphane (PubChem CID 162462392) has the molecular formula C52H59O2P and a molecular weight of 747.02 g/mol. Its IUPAC name is bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-tert-butylphosphane.
| Compound Name | bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-tert-butylphosphane |
|---|---|
| PubChem CID | 162462392 |
| Molecular Formula | C52H59O2P |
| Molecular Weight | 747.02 g/mol |
| Exact Mass | 746.43 |
| IUPAC Name | bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-tert-butylphosphane |
| SMILES | CC(C)(c1ccccc1)c1ccc(OP(Oc2ccc(C(C)(C)c3ccccc3)cc2C(C)(C)c2ccccc2)C(C)(C)C)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C52H59O2P/c1-48(2,3)55(53-46-34-32-42(49(4,5)38-24-16-12-17-25-38)36-44(46)51(8,9)40-28-20-14-21-29-40)54-47-35-33-43(50(6,7)39-26-18-13-19-27-39)37-45(47)52(10,11)41-30-22-15-23-31-41/h12-37H,1-11H3 |
| InChIKey | WIRDXSSXIHLCFI-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.02 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|