C40H43O3P — CID 58388390
[2,4-bis(2-phenylpropan-2-yl)phenyl] methyl [4-(2-phenylpropan-2-yl)phenyl] phosphite (PubChem CID 58388390) has the molecular formula C40H43O3P and a molecular weight of 602.76 g/mol. Its IUPAC name is [2,4-bis(2-phenylpropan-2-yl)phenyl] methyl [4-(2-phenylpropan-2-yl)phenyl] phosphite.
| Compound Name | [2,4-bis(2-phenylpropan-2-yl)phenyl] methyl [4-(2-phenylpropan-2-yl)phenyl] phosphite |
|---|---|
| PubChem CID | 58388390 |
| Molecular Formula | C40H43O3P |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [2,4-bis(2-phenylpropan-2-yl)phenyl] methyl [4-(2-phenylpropan-2-yl)phenyl] phosphite |
| SMILES | COP(Oc1ccc(C(C)(C)c2ccccc2)cc1)Oc1ccc(C(C)(C)c2ccccc2)cc1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C40H43O3P/c1-38(2,30-17-11-8-12-18-30)33-23-26-35(27-24-33)42-44(41-7)43-37-28-25-34(39(3,4)31-19-13-9-14-20-31)29-36(37)40(5,6)32-21-15-10-16-22-32/h8-29H,1-7H3 |
| InChIKey | UTKIQBZOMVHTHY-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|