C56H71O5PS — CID 15218832
[4-(benzenesulfonyl)phenyl] bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite (PubChem CID 15218832) has the molecular formula C56H71O5PS and a molecular weight of 887.22 g/mol. Its IUPAC name is [4-(benzenesulfonyl)phenyl] bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite.
| Compound Name | [4-(benzenesulfonyl)phenyl] bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
|---|---|
| PubChem CID | 15218832 |
| Molecular Formula | C56H71O5PS |
| Molecular Weight | 887.22 g/mol |
| Exact Mass | 886.48 |
| IUPAC Name | [4-(benzenesulfonyl)phenyl] bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2cc(OP(Oc3ccc(S(=O)(=O)c4ccccc4)cc3)Oc3cc4c(C(C)(C)C)cc(C(C)(C)C)cc4cc3C(C)(C)C)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C56H71O5PS/c1-51(2,3)38-28-36-30-47(55(13,14)15)49(34-43(36)45(32-38)53(7,8)9)60-62(59-40-24-26-42(27-25-40)63(57,58)41-22-20-19-21-23-41)61-50-35-44-37(31-48(50)56(16,17)18)29-39(52(4,5)6)33-46(44)54(10,11)12/h19-35H,1-18H3 |
| InChIKey | AJWYFKFKVODSAR-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.22 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|