C46H59O3P — CID 23002710
(2-tert-butylphenyl) bis(3,6-ditert-butylnaphthalen-2-yl) phosphite (PubChem CID 23002710) has the molecular formula C46H59O3P and a molecular weight of 690.95 g/mol. Its IUPAC name is (2-tert-butylphenyl) bis(3,6-ditert-butylnaphthalen-2-yl) phosphite.
| Compound Name | (2-tert-butylphenyl) bis(3,6-ditert-butylnaphthalen-2-yl) phosphite |
|---|---|
| PubChem CID | 23002710 |
| Molecular Formula | C46H59O3P |
| Molecular Weight | 690.95 g/mol |
| Exact Mass | 690.42 |
| IUPAC Name | (2-tert-butylphenyl) bis(3,6-ditert-butylnaphthalen-2-yl) phosphite |
| SMILES | CC(C)(C)c1ccc2cc(OP(Oc3ccccc3C(C)(C)C)Oc3cc4ccc(C(C)(C)C)cc4cc3C(C)(C)C)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C46H59O3P/c1-42(2,3)34-22-20-30-28-40(37(45(10,11)12)26-32(30)24-34)48-50(47-39-19-17-16-18-36(39)44(7,8)9)49-41-29-31-21-23-35(43(4,5)6)25-33(31)27-38(41)46(13,14)15/h16-29H,1-15H3 |
| InChIKey | JNIHGVDGVJZBFA-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.95 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|