C51H69O4P — CID 19087227
(4-methoxyphenyl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite (PubChem CID 19087227) has the molecular formula C51H69O4P and a molecular weight of 777.08 g/mol. Its IUPAC name is (4-methoxyphenyl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite.
| Compound Name | (4-methoxyphenyl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
|---|---|
| PubChem CID | 19087227 |
| Molecular Formula | C51H69O4P |
| Molecular Weight | 777.08 g/mol |
| Exact Mass | 776.49 |
| IUPAC Name | (4-methoxyphenyl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
| SMILES | COc1ccc(OP(Oc2cc3c(C(C)(C)C)cc(C(C)(C)C)cc3cc2C(C)(C)C)Oc2cc3c(C(C)(C)C)cc(C(C)(C)C)cc3cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C51H69O4P/c1-46(2,3)34-24-32-26-42(50(13,14)15)44(30-38(32)40(28-34)48(7,8)9)54-56(53-37-22-20-36(52-19)21-23-37)55-45-31-39-33(27-43(45)51(16,17)18)25-35(47(4,5)6)29-41(39)49(10,11)12/h20-31H,1-19H3 |
| InChIKey | JUZTVKSSXVEHLK-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.08 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|