C70H64O8P2 — CID 140827254
[2-[2-bis(4-phenylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] bis(4-phenylphenyl) phosphite (PubChem CID 140827254) has the molecular formula C70H64O8P2 and a molecular weight of 1095.22 g/mol. Its IUPAC name is [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] bis(4-phenylphenyl) phosphite.
| Compound Name | [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] bis(4-phenylphenyl) phosphite |
|---|---|
| PubChem CID | 140827254 |
| Molecular Formula | C70H64O8P2 |
| Molecular Weight | 1095.22 g/mol |
| Exact Mass | 1094.41 |
| IUPAC Name | [2-[2-bis(4-phenylphenoxy)phosphanyloxy-3-tert-butyl-5-methoxyphenyl]-6-tert-butyl-4-methoxyphenyl] bis(4-phenylphenyl) phosphite |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2OP(Oc2ccc(-c3ccccc3)cc2)Oc2ccc(-c3ccccc3)cc2)c(OP(Oc2ccc(-c3ccccc3)cc2)Oc2ccc(-c3ccccc3)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H64O8P2/c1-69(2,3)65-47-61(71-7)45-63(67(65)77-79(73-57-37-29-53(30-38-57)49-21-13-9-14-22-49)74-58-39-31-54(32-40-58)50-23-15-10-16-24-50)64-46-62(72-8)48-66(70(4,5)6)68(64)78-80(75-59-41-33-55(34-42-59)51-25-17-11-18-26-51)76-60-43-35-56(36-44-60)52-27-19-12-20-28-52/h9-48H,1-8H3 |
| InChIKey | HEUCANFTPORBQT-UHFFFAOYSA-N |
| XLogP | 20.16 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.22 |
| LogP ≤ 5 | 20.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|