C68H62O8P2 — CID 165162014
[2-tert-butyl-6-[3-tert-butyl-5-methoxy-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]-4-methoxyphenyl] dinaphthalen-1-yl phosphite (PubChem CID 165162014) has the molecular formula C68H62O8P2 and a molecular weight of 1069.18 g/mol. Its IUPAC name is [2-tert-butyl-6-[3-tert-butyl-5-methoxy-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]-4-methoxyphenyl] dinaphthalen-1-yl phosphite.
| Compound Name | [2-tert-butyl-6-[3-tert-butyl-5-methoxy-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]-4-methoxyphenyl] dinaphthalen-1-yl phosphite |
|---|---|
| PubChem CID | 165162014 |
| Molecular Formula | C68H62O8P2 |
| Molecular Weight | 1069.18 g/mol |
| Exact Mass | 1068.39 |
| IUPAC Name | [2-tert-butyl-6-[3-tert-butyl-5-methoxy-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]-4-methoxyphenyl] dinaphthalen-1-yl phosphite |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2OP2OC(c3ccccc3)(c3ccccc3)C(c3ccccc3)(c3ccccc3)O2)c(OP(Oc2cccc3ccccc23)Oc2cccc3ccccc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H62O8P2/c1-65(2,3)59-45-53(69-7)43-57(63(59)73-77(71-61-41-25-29-47-27-21-23-39-55(47)61)72-62-42-26-30-48-28-22-24-40-56(48)62)58-44-54(70-8)46-60(66(4,5)6)64(58)74-78-75-67(49-31-13-9-14-32-49,50-33-15-10-16-34-50)68(76-78,51-35-17-11-18-36-51)52-37-19-12-20-38-52/h9-46H,1-8H3 |
| InChIKey | MRWCNKLKKUWTRN-UHFFFAOYSA-N |
| XLogP | 18.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.18 |
| LogP ≤ 5 | 18.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|