C62H69O6P — CID 175795609
2-[2-tert-butyl-6-[3-tert-butyl-2-(3,5-ditert-butylphenoxy)-5-methoxyphenyl]-4-methoxyphenoxy]-4,4,5,5-tetraphenyl-1,3,2-dioxaphospholane (PubChem CID 175795609) has the molecular formula C62H69O6P and a molecular weight of 941.20 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[3-tert-butyl-2-(3,5-ditert-butylphenoxy)-5-methoxyphenyl]-4-methoxyphenoxy]-4,4,5,5-tetraphenyl-1,3,2-dioxaphospholane.
| Compound Name | 2-[2-tert-butyl-6-[3-tert-butyl-2-(3,5-ditert-butylphenoxy)-5-methoxyphenyl]-4-methoxyphenoxy]-4,4,5,5-tetraphenyl-1,3,2-dioxaphospholane |
|---|---|
| PubChem CID | 175795609 |
| Molecular Formula | C62H69O6P |
| Molecular Weight | 941.20 g/mol |
| Exact Mass | 940.48 |
| IUPAC Name | 2-[2-tert-butyl-6-[3-tert-butyl-2-(3,5-ditert-butylphenoxy)-5-methoxyphenyl]-4-methoxyphenoxy]-4,4,5,5-tetraphenyl-1,3,2-dioxaphospholane |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2OP2OC(c3ccccc3)(c3ccccc3)C(c3ccccc3)(c3ccccc3)O2)c(Oc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H69O6P/c1-57(2,3)46-35-47(58(4,5)6)37-50(36-46)65-55-51(38-48(63-13)40-53(55)59(7,8)9)52-39-49(64-14)41-54(60(10,11)12)56(52)66-69-67-61(42-27-19-15-20-28-42,43-29-21-16-22-30-43)62(68-69,44-31-23-17-24-32-44)45-33-25-18-26-34-45/h15-41H,1-14H3 |
| InChIKey | NXIFLXBDHJMIIB-UHFFFAOYSA-N |
| XLogP | 16.89 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.20 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|