C24H33O3P — CID 14945673
2-(2,4,6-tritert-butylphenoxy)-1,3,2-benzodioxaphosphole (PubChem CID 14945673) has the molecular formula C24H33O3P and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(2,4,6-tritert-butylphenoxy)-1,3,2-benzodioxaphosphole.
| Compound Name | 2-(2,4,6-tritert-butylphenoxy)-1,3,2-benzodioxaphosphole |
|---|---|
| PubChem CID | 14945673 |
| Molecular Formula | C24H33O3P |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-(2,4,6-tritert-butylphenoxy)-1,3,2-benzodioxaphosphole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OP2Oc3ccccc3O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33O3P/c1-22(2,3)16-14-17(23(4,5)6)21(18(15-16)24(7,8)9)27-28-25-19-12-10-11-13-20(19)26-28/h10-15H,1-9H3 |
| InChIKey | PACVIAFOBHITKJ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|