C59H69O6P — CID 118530084
tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate (PubChem CID 118530084) has the molecular formula C59H69O6P and a molecular weight of 905.17 g/mol. Its IUPAC name is tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 118530084 |
| Molecular Formula | C59H69O6P |
| Molecular Weight | 905.17 g/mol |
| Exact Mass | 904.48 |
| IUPAC Name | tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP2OC(c3ccccc3)(c3ccccc3)C(c3ccccc3)(c3ccccc3)O2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C59H69O6P/c1-53(2,3)44-36-46(50(48(38-44)55(7,8)9)61-52(60)62-57(13,14)15)47-37-45(54(4,5)6)39-49(56(10,11)12)51(47)63-66-64-58(40-28-20-16-21-29-40,41-30-22-17-23-31-41)59(65-66,42-32-24-18-25-33-42)43-34-26-19-27-35-43/h16-39H,1-15H3 |
| InChIKey | VQQMMRDJCDVIND-UHFFFAOYSA-N |
| XLogP | 16.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.17 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|