C60H87N3O12 — CID 130208235
[4-[[4,6-bis[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenoxy]-1,3,5-triazin-2-yl]oxy]-2,6-ditert-butylphenyl] tert-butyl carbonate (PubChem CID 130208235) has the molecular formula C60H87N3O12 and a molecular weight of 1042.36 g/mol. Its IUPAC name is [4-[[4,6-bis[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenoxy]-1,3,5-triazin-2-yl]oxy]-2,6-ditert-butylphenyl] tert-butyl carbonate.
| Compound Name | [4-[[4,6-bis[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenoxy]-1,3,5-triazin-2-yl]oxy]-2,6-ditert-butylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 130208235 |
| Molecular Formula | C60H87N3O12 |
| Molecular Weight | 1042.36 g/mol |
| Exact Mass | 1041.63 |
| IUPAC Name | [4-[[4,6-bis[3,5-ditert-butyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenoxy]-1,3,5-triazin-2-yl]oxy]-2,6-ditert-butylphenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1c(C(C)(C)C)cc(Oc2nc(Oc3cc(C(C)(C)C)c(OC(=O)OC(C)(C)C)c(C(C)(C)C)c3)nc(Oc3cc(C(C)(C)C)c(OC(=O)OC(C)(C)C)c(C(C)(C)C)c3)n2)cc1C(C)(C)C |
| InChI | InChI=1S/C60H87N3O12/c1-52(2,3)37-28-34(29-38(53(4,5)6)43(37)70-49(64)73-58(19,20)21)67-46-61-47(68-35-30-39(54(7,8)9)44(40(31-35)55(10,11)12)71-50(65)74-59(22,23)24)63-48(62-46)69-36-32-41(56(13,14)15)45(42(33-36)57(16,17)18)72-51(66)75-60(25,26)27/h28-33H,1-27H3 |
| InChIKey | PPTQVBQSEMMSFD-UHFFFAOYSA-N |
| XLogP | 16.98 |
| TPSA | 172.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.36 |
| LogP ≤ 5 | 16.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|