C49H67O8P — CID 118530073
[2-[2-bis(2-tert-butyl-4-methoxyphenoxy)phosphanyloxy-3-tert-butyl-5-methylphenyl]-6-tert-butyl-4-methylphenyl] tert-butyl carbonate (PubChem CID 118530073) has the molecular formula C49H67O8P and a molecular weight of 815.04 g/mol. Its IUPAC name is [2-[2-bis(2-tert-butyl-4-methoxyphenoxy)phosphanyloxy-3-tert-butyl-5-methylphenyl]-6-tert-butyl-4-methylphenyl] tert-butyl carbonate.
| Compound Name | [2-[2-bis(2-tert-butyl-4-methoxyphenoxy)phosphanyloxy-3-tert-butyl-5-methylphenyl]-6-tert-butyl-4-methylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118530073 |
| Molecular Formula | C49H67O8P |
| Molecular Weight | 815.04 g/mol |
| Exact Mass | 814.46 |
| IUPAC Name | [2-[2-bis(2-tert-butyl-4-methoxyphenoxy)phosphanyloxy-3-tert-butyl-5-methylphenyl]-6-tert-butyl-4-methylphenyl] tert-butyl carbonate |
| SMILES | COc1ccc(OP(Oc2ccc(OC)cc2C(C)(C)C)Oc2c(-c3cc(C)cc(C(C)(C)C)c3OC(=O)OC(C)(C)C)cc(C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C49H67O8P/c1-30-24-34(42(38(26-30)47(9,10)11)53-44(50)54-49(15,16)17)35-25-31(2)27-39(48(12,13)14)43(35)57-58(55-40-22-20-32(51-18)28-36(40)45(3,4)5)56-41-23-21-33(52-19)29-37(41)46(6,7)8/h20-29H,1-19H3 |
| InChIKey | VMCMVQLGVJKKNV-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.04 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|