C49H65O6P — CID 118530076
tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] carbonate (PubChem CID 118530076) has the molecular formula C49H65O6P and a molecular weight of 781.03 g/mol. Its IUPAC name is tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 118530076 |
| Molecular Formula | C49H65O6P |
| Molecular Weight | 781.03 g/mol |
| Exact Mass | 780.45 |
| IUPAC Name | tert-butyl [2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(2,4,8,10-tetramethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenyl] carbonate |
| SMILES | Cc1cc(C)c2op(Oc3c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4OC(=O)OC(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)oc3c(C)cc(C)cc3c2c1 |
| InChI | InChI=1S/C49H65O6P/c1-28-20-30(3)40-34(22-28)35-23-29(2)21-31(4)41(35)54-56(53-40)55-43-37(25-33(46(8,9)10)27-39(43)48(14,15)16)36-24-32(45(5,6)7)26-38(47(11,12)13)42(36)51-44(50)52-49(17,18)19/h20-27H,1-19H3 |
| InChIKey | GLDJLMMXGIVAHN-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.03 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|