C41H37O6P — CID 118530096
tert-butyl [2-[2-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3,5-dimethylphenyl]-4,6-dimethylphenyl] carbonate (PubChem CID 118530096) has the molecular formula C41H37O6P and a molecular weight of 656.71 g/mol. Its IUPAC name is tert-butyl [2-[2-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3,5-dimethylphenyl]-4,6-dimethylphenyl] carbonate.
| Compound Name | tert-butyl [2-[2-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3,5-dimethylphenyl]-4,6-dimethylphenyl] carbonate |
|---|---|
| PubChem CID | 118530096 |
| Molecular Formula | C41H37O6P |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | tert-butyl [2-[2-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yloxy)-3,5-dimethylphenyl]-4,6-dimethylphenyl] carbonate |
| SMILES | Cc1cc(C)c(OC(=O)OC(C)(C)C)c(-c2cc(C)cc(C)c2Op2oc3ccc4ccccc4c3c3c(ccc4ccccc43)o2)c1 |
| InChI | InChI=1S/C41H37O6P/c1-24-20-26(3)38(43-40(42)44-41(5,6)7)32(22-24)33-23-25(2)21-27(4)39(33)47-48-45-34-18-16-28-12-8-10-14-30(28)36(34)37-31-15-11-9-13-29(31)17-19-35(37)46-48/h8-23H,1-7H3 |
| InChIKey | IENDHAKPESTPDL-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|