C50H69O4P — CID 139721800
2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenol (PubChem CID 139721800) has the molecular formula C50H69O4P and a molecular weight of 765.07 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenol |
|---|---|
| PubChem CID | 139721800 |
| Molecular Formula | C50H69O4P |
| Molecular Weight | 765.07 g/mol |
| Exact Mass | 764.49 |
| IUPAC Name | 2,4-ditert-butyl-6-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]phenol |
| SMILES | Cc1cc(C(C)(C)C)c2op(Oc3c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)cc(C(C)(C)C)cc3C(C)(C)C)oc3c(C(C)(C)C)cc(C)cc3c2c1 |
| InChI | InChI=1S/C50H69O4P/c1-29-21-34-35-22-30(2)24-39(49(15,16)17)43(35)53-55(52-42(34)38(23-29)48(12,13)14)54-44-36(26-32(46(6,7)8)28-40(44)50(18,19)20)33-25-31(45(3,4)5)27-37(41(33)51)47(9,10)11/h21-28,51H,1-20H3 |
| InChIKey | JVWCBQZRAHTYGK-UHFFFAOYSA-N |
| XLogP | 15.91 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.07 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |